C22H29NO6 — CID 55595817
N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 55595817) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55595817 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(C(C)NC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H29NO6/c1-14(16-8-9-17(25-2)18(13-16)26-3)23-21(24)10-7-15-11-19(27-4)22(29-6)20(12-15)28-5/h8-9,11-14H,7,10H2,1-6H3,(H,23,24) |
| InChIKey | DUVPPDIXKUBDPG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |