C23H31NO5 — CID 99949595
3-(3,4-diethoxyphenyl)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 99949595) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 99949595 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | CCOc1ccc(CCC(=O)N[C@@H](C)c2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C23H31NO5/c1-6-28-20-11-8-17(14-22(20)29-7-2)9-13-23(25)24-16(3)18-10-12-19(26-4)21(15-18)27-5/h8,10-12,14-16H,6-7,9,13H2,1-5H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | ULXXQTYIHMENTB-INIZCTEOSA-N |
| XLogP | 4.31 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |