C17H17FN2O2 — CID 134026833
N-(2-amino-2-oxo-1-phenylethyl)-3-(3-fluorophenyl)propanamide (PubChem CID 134026833) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-3-(3-fluorophenyl)propanamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 134026833 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-3-(3-fluorophenyl)propanamide |
| SMILES | NC(=O)C(NC(=O)CCc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H17FN2O2/c18-14-8-4-5-12(11-14)9-10-15(21)20-16(17(19)22)13-6-2-1-3-7-13/h1-8,11,16H,9-10H2,(H2,19,22)(H,20,21) |
| InChIKey | HTLZHPKFCGSCIU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |