C20H31N4O3+ — CID 7205119
[6-[[(1R,2S)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl]amino]-6-oxohexyl]azanium (PubChem CID 7205119) has the molecular formula C20H31N4O3+ and a molecular weight of 375.49 g/mol. Its IUPAC name is [6-[[(1R,2S)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl]amino]-6-oxohexyl]azanium.
| Compound Name | [6-[[(1R,2S)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl]amino]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 7205119 |
| Molecular Formula | C20H31N4O3+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [6-[[(1R,2S)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl]amino]-6-oxohexyl]azanium |
| SMILES | CC[C@H](C)[C@@H](NC(=O)CCCCC[NH3+])c1nc(-c2cccc(OC)c2)no1 |
| InChI | InChI=1S/C20H30N4O3/c1-4-14(2)18(22-17(25)11-6-5-7-12-21)20-23-19(24-27-20)15-9-8-10-16(13-15)26-3/h8-10,13-14,18H,4-7,11-12,21H2,1-3H3,(H,22,25)/p+1/t14-,18+/m0/s1 |
| InChIKey | ADLKCRCAXBSMFU-KBXCAEBGSA-O |
| XLogP | 2.75 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|