C18H24ClN3O5 — CID 42797782
2-chloro-N-[2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide (PubChem CID 42797782) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-chloro-N-[2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide.
| Compound Name | 2-chloro-N-[2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide |
|---|---|
| PubChem CID | 42797782 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-chloro-N-[2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide |
| SMILES | CCC(C)C(NC(=O)CCl)c1nc(-c2cc(OC)c(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C18H24ClN3O5/c1-6-10(2)15(20-14(23)9-19)18-21-17(22-27-18)11-7-12(24-3)16(26-5)13(8-11)25-4/h7-8,10,15H,6,9H2,1-5H3,(H,20,23) |
| InChIKey | RVQAHHJFWASTLU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|