C24H26F3N3O5 — CID 93117468
N-[(1R,2R)-2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-(trifluoromethyl)benzamide (PubChem CID 93117468) has the molecular formula C24H26F3N3O5 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-[(1R,2R)-2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,2R)-2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 93117468 |
| Molecular Formula | C24H26F3N3O5 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[(1R,2R)-2-methyl-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccc(C(F)(F)F)cc1)c1nc(-c2cc(OC)c(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C24H26F3N3O5/c1-6-13(2)19(28-22(31)14-7-9-16(10-8-14)24(25,26)27)23-29-21(30-35-23)15-11-17(32-3)20(34-5)18(12-15)33-4/h7-13,19H,6H2,1-5H3,(H,28,31)/t13-,19-/m1/s1 |
| InChIKey | CEZDOBRRLWYZJK-BFUOFWGJSA-N |
| XLogP | 5.30 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |