C15H18ClN3O5 — CID 42797709
2-chloro-N-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]propanamide (PubChem CID 42797709) has the molecular formula C15H18ClN3O5 and a molecular weight of 355.78 g/mol. Its IUPAC name is 2-chloro-N-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]propanamide.
| Compound Name | 2-chloro-N-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]propanamide |
|---|---|
| PubChem CID | 42797709 |
| Molecular Formula | C15H18ClN3O5 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-chloro-N-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]propanamide |
| SMILES | COc1cc(-c2noc(CNC(=O)C(C)Cl)n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18ClN3O5/c1-8(16)15(20)17-7-12-18-14(19-24-12)9-5-10(21-2)13(23-4)11(6-9)22-3/h5-6,8H,7H2,1-4H3,(H,17,20) |
| InChIKey | SONKDHMGRRZSDO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|