C19H27N3O6 — CID 4887245
N-(3-methoxypropyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide (PubChem CID 4887245) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide.
| Compound Name | N-(3-methoxypropyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
|---|---|
| PubChem CID | 4887245 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-(3-methoxypropyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
| SMILES | COCCCNC(=O)CCCc1nc(-c2cc(OC)c(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C19H27N3O6/c1-24-10-6-9-20-16(23)7-5-8-17-21-19(22-28-17)13-11-14(25-2)18(27-4)15(12-13)26-3/h11-12H,5-10H2,1-4H3,(H,20,23) |
| InChIKey | ZONFTLZYYWEQNB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|