C18H25N3O4 — CID 18108283
3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pentylpropanamide (PubChem CID 18108283) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pentylpropanamide.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 18108283 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCc1nc(-c2ccc(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C18H25N3O4/c1-4-5-6-11-19-16(22)9-10-17-20-18(21-25-17)13-7-8-14(23-2)15(12-13)24-3/h7-8,12H,4-6,9-11H2,1-3H3,(H,19,22) |
| InChIKey | PCJHOJQCMCZSIA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|