C17H23N3O5 — CID 2031380
4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methoxyethyl)butanamide (PubChem CID 2031380) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 2031380 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCc1nc(-c2ccc(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C17H23N3O5/c1-22-10-9-18-15(21)5-4-6-16-19-17(20-25-16)12-7-8-13(23-2)14(11-12)24-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,21) |
| InChIKey | YMHOWFSMUMURMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|