C20H21N3O5 — CID 46263763
4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-hydroxyphenyl)butanamide (PubChem CID 46263763) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-hydroxyphenyl)butanamide.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 46263763 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-hydroxyphenyl)butanamide |
| SMILES | COc1ccc(-c2noc(CCCC(=O)Nc3ccc(O)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-26-16-11-6-13(12-17(16)27-2)20-22-19(28-23-20)5-3-4-18(25)21-14-7-9-15(24)10-8-14/h6-12,24H,3-5H2,1-2H3,(H,21,25) |
| InChIKey | QUSKZQRSQGLKMF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|