C17H24N2O3 — CID 19658114
3-(3,4-dimethoxyphenyl)-5-heptyl-1,2,4-oxadiazole (PubChem CID 19658114) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-heptyl-1,2,4-oxadiazole.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-heptyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19658114 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-heptyl-1,2,4-oxadiazole |
| SMILES | CCCCCCCc1nc(-c2ccc(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-5-6-7-8-9-16-18-17(19-22-16)13-10-11-14(20-2)15(12-13)21-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | WJBMXNODJSVLTQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|