C13H16N2O — CID 19658049
5-pentyl-3-phenyl-1,2,4-oxadiazole (PubChem CID 19658049) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-pentyl-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-pentyl-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19658049 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-pentyl-3-phenyl-1,2,4-oxadiazole |
| SMILES | CCCCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C13H16N2O/c1-2-3-5-10-12-14-13(15-16-12)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| InChIKey | HSAFUOMYPSLFOV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|