C21H32N4O — CID 155566908
5-[(4-octylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 155566908) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-[(4-octylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[(4-octylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155566908 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 5-[(4-octylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | CCCCCCCCN1CCN(Cc2nc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C21H32N4O/c1-2-3-4-5-6-10-13-24-14-16-25(17-15-24)18-20-22-21(23-26-20)19-11-8-7-9-12-19/h7-9,11-12H,2-6,10,13-18H2,1H3 |
| InChIKey | XDWDIWZHIBVUCG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|