C11H13N3O — CID 26772271
5-butyl-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 26772271) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-butyl-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-butyl-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26772271 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-butyl-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | CCCCc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C11H13N3O/c1-2-3-7-10-13-11(14-15-10)9-6-4-5-8-12-9/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | CBTIVXQPAICXGQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |