C10H9N3O3 — CID 79474815
methyl 2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetate (PubChem CID 79474815) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is methyl 2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetate.
| Compound Name | methyl 2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetate |
|---|---|
| PubChem CID | 79474815 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | methyl 2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetate |
| SMILES | COC(=O)Cc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C10H9N3O3/c1-15-9(14)6-8-12-10(13-16-8)7-4-2-3-5-11-7/h2-5H,6H2,1H3 |
| InChIKey | RKLBKYLCYJJWBX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |