C11H9ClN2O3 — CID 79474434
methyl 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetate (PubChem CID 79474434) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is methyl 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetate.
| Compound Name | methyl 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetate |
|---|---|
| PubChem CID | 79474434 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetate |
| SMILES | COC(=O)Cc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C11H9ClN2O3/c1-16-10(15)6-9-13-11(14-17-9)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3 |
| InChIKey | GXKGHKQRGISUGS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |