C16H11ClN2O3 — CID 19657942
methyl 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoate (PubChem CID 19657942) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is methyl 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoate.
| Compound Name | methyl 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoate |
|---|---|
| PubChem CID | 19657942 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | methyl 4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(-c3ccccc3Cl)no2)cc1 |
| InChI | InChI=1S/C16H11ClN2O3/c1-21-16(20)11-8-6-10(7-9-11)15-18-14(19-22-15)12-4-2-3-5-13(12)17/h2-9H,1H3 |
| InChIKey | KEIIOYIPNXBTNI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |