methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate

C14H16N2O3 — CID 59913410

IUPACmethyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate
SMILESCCCCc1noc(-c2ccc(C(=O)OC)cc2)n1
InChIInChI=1S/C14H16N2O3/c1-3-4-5-12-15-13(19-16-12)10-6-8-11(9-7-10)14(17)18-2/h6-9H,3-5H2,1-2H3
InChIKeyMSFQGBCUYOMBGS-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.87
Rot. Bonds5

About methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate

methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate (PubChem CID 59913410) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate
PubChem CID59913410
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Namemethyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate
SMILESCCCCc1noc(-c2ccc(C(=O)OC)cc2)n1
InChIInChI=1S/C14H16N2O3/c1-3-4-5-12-15-13(19-16-12)10-6-8-11(9-7-10)14(17)18-2/h6-9H,3-5H2,1-2H3
InChIKeyMSFQGBCUYOMBGS-UHFFFAOYSA-N
XLogP2.87
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate?
The IUPAC name of methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate (CID 59913410) is methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate.
What is the SMILES notation for methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate?
The canonical SMILES for methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate is CCCCc1noc(-c2ccc(C(=O)OC)cc2)n1.
What is the InChIKey of methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate?
The InChIKey is MSFQGBCUYOMBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-3-4-5-12-15-13(19-16-12)10-6-8-11(9-7-10)14(17)18-2/h6-9H,3-5H2,1-2H3.
What are the key properties of methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate?
methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate has a molecular weight of 260.29 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-butyl-1,2,4-oxadiazol-5-yl)benzoate is sourced from PubChem (CID 59913410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).