methyl 4-[4-(4-propylphenyl)phenyl]benzoate

C23H22O2 — CID 142331537

IUPACmethyl 4-[4-(4-propylphenyl)phenyl]benzoate
SMILESCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1
InChIInChI=1S/C23H22O2/c1-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(24)25-2/h5-16H,3-4H2,1-2H3
InChIKeyWSJDAQMGJQEGSQ-UHFFFAOYSA-N
MW330.43 g/mol
LogP5.76
Rot. Bonds5

About methyl 4-[4-(4-propylphenyl)phenyl]benzoate

methyl 4-[4-(4-propylphenyl)phenyl]benzoate (PubChem CID 142331537) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 4-[4-(4-propylphenyl)phenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(4-propylphenyl)phenyl]benzoate
PubChem CID142331537
Molecular FormulaC23H22O2
Molecular Weight330.43 g/mol
Exact Mass330.16
IUPAC Namemethyl 4-[4-(4-propylphenyl)phenyl]benzoate
SMILESCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1
InChIInChI=1S/C23H22O2/c1-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(24)25-2/h5-16H,3-4H2,1-2H3
InChIKeyWSJDAQMGJQEGSQ-UHFFFAOYSA-N
XLogP5.76
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500330.43
LogP ≤ 55.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-[4-(4-propylphenyl)phenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(4-propylphenyl)phenyl]benzoate?
The IUPAC name of methyl 4-[4-(4-propylphenyl)phenyl]benzoate (CID 142331537) is methyl 4-[4-(4-propylphenyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-[4-(4-propylphenyl)phenyl]benzoate?
The canonical SMILES for methyl 4-[4-(4-propylphenyl)phenyl]benzoate is CCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1.
What is the InChIKey of methyl 4-[4-(4-propylphenyl)phenyl]benzoate?
The InChIKey is WSJDAQMGJQEGSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O2/c1-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(24)25-2/h5-16H,3-4H2,1-2H3.
What are the key properties of methyl 4-[4-(4-propylphenyl)phenyl]benzoate?
methyl 4-[4-(4-propylphenyl)phenyl]benzoate has a molecular weight of 330.43 g/mol, XLogP of 5.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(4-propylphenyl)phenyl]benzoate is sourced from PubChem (CID 142331537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).