C16H12N2O4 — CID 75456998
methyl 4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 75456998) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is methyl 4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 75456998 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2noc(-c3cccc(O)c3)n2)cc1 |
| InChI | InChI=1S/C16H12N2O4/c1-21-16(20)11-7-5-10(6-8-11)14-17-15(22-18-14)12-3-2-4-13(19)9-12/h2-9,19H,1H3 |
| InChIKey | NPRSMDAXLAENRK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |