C14H9FN2O3 — CID 136871097
2-fluoro-4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 136871097) has the molecular formula C14H9FN2O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-fluoro-4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 2-fluoro-4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 136871097 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-fluoro-4-[5-(3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1cccc(-c2nc(-c3ccc(O)c(F)c3)no2)c1 |
| InChI | InChI=1S/C14H9FN2O3/c15-11-7-8(4-5-12(11)19)13-16-14(20-17-13)9-2-1-3-10(18)6-9/h1-7,18-19H |
| InChIKey | BIBSNQGMWJAUGJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |