C14H9F2N3O2 — CID 136810165
4-[5-(4-amino-3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-2-fluorophenol (PubChem CID 136810165) has the molecular formula C14H9F2N3O2 and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-[5-(4-amino-3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-2-fluorophenol.
| Compound Name | 4-[5-(4-amino-3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 136810165 |
| Molecular Formula | C14H9F2N3O2 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[5-(4-amino-3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-2-fluorophenol |
| SMILES | Nc1ccc(-c2nc(-c3ccc(O)c(F)c3)no2)cc1F |
| InChI | InChI=1S/C14H9F2N3O2/c15-9-6-8(1-3-11(9)17)14-18-13(19-21-14)7-2-4-12(20)10(16)5-7/h1-6,20H,17H2 |
| InChIKey | FRUZNLRGBSTKLL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|