C14H10FN3O3 — CID 136810050
2-amino-6-[3-(3-fluoro-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136810050) has the molecular formula C14H10FN3O3 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-amino-6-[3-(3-fluoro-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(3-fluoro-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136810050 |
| Molecular Formula | C14H10FN3O3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-amino-6-[3-(3-fluoro-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cccc(-c2nc(-c3ccc(O)c(F)c3)no2)c1O |
| InChI | InChI=1S/C14H10FN3O3/c15-9-6-7(4-5-11(9)19)13-17-14(21-18-13)8-2-1-3-10(16)12(8)20/h1-6,19-20H,16H2 |
| InChIKey | SUQPAFNVWNUMHP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|