C14H9Cl2N3O2 — CID 136888709
2-amino-6-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136888709) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-amino-6-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136888709 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-amino-6-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cccc(-c2nc(-c3cc(Cl)cc(Cl)c3)no2)c1O |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-8-4-7(5-9(16)6-8)13-18-14(21-19-13)10-2-1-3-11(17)12(10)20/h1-6,20H,17H2 |
| InChIKey | UVDNHASQSREMLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|