C12H9N3O3 — CID 136712714
2-amino-6-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136712714) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-amino-6-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136712714 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-amino-6-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cccc(-c2nc(-c3ccco3)no2)c1O |
| InChI | InChI=1S/C12H9N3O3/c13-8-4-1-3-7(10(8)16)12-14-11(15-18-12)9-5-2-6-17-9/h1-6,16H,13H2 |
| InChIKey | HQXFZVDOHNZYIQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|