C13H10N2O3 — CID 136751072
4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylphenol (PubChem CID 136751072) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylphenol.
| Compound Name | 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylphenol |
|---|---|
| PubChem CID | 136751072 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1-c1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C13H10N2O3/c1-8-7-9(16)4-5-10(8)13-14-12(15-18-13)11-3-2-6-17-11/h2-7,16H,1H3 |
| InChIKey | HSYUCTQJNGCYNX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |