C14H11N3O3 — CID 30333041
N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide (PubChem CID 30333041) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide.
| Compound Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 30333041 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1-c1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C14H11N3O3/c1-9(18)15-11-6-3-2-5-10(11)14-16-13(17-20-14)12-7-4-8-19-12/h2-8H,1H3,(H,15,18) |
| InChIKey | AIPXAVBRYZDOIW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |