C19H12BrN3O3 — CID 30329560
2-bromo-N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide (PubChem CID 30329560) has the molecular formula C19H12BrN3O3 and a molecular weight of 410.23 g/mol. Its IUPAC name is 2-bromo-N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 30329560 |
| Molecular Formula | C19H12BrN3O3 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 2-bromo-N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc(-c2ccco2)no1)c1ccccc1Br |
| InChI | InChI=1S/C19H12BrN3O3/c20-14-8-3-1-6-12(14)18(24)21-15-9-4-2-7-13(15)19-22-17(23-26-19)16-10-5-11-25-16/h1-11H,(H,21,24) |
| InChIKey | GOOONAYSSZMLFO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |