C20H15N3O4 — CID 30330455
N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]-2-methoxybenzamide (PubChem CID 30330455) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 30330455 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccccc1-c1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C20H15N3O4/c1-25-16-10-5-3-8-14(16)19(24)21-15-9-4-2-7-13(15)20-22-18(23-27-20)17-11-6-12-26-17/h2-12H,1H3,(H,21,24) |
| InChIKey | UHMHONXVUPSFMH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |