C24H20IN3O5 — CID 43903830
2-iodo-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide (PubChem CID 43903830) has the molecular formula C24H20IN3O5 and a molecular weight of 557.34 g/mol. Its IUPAC name is 2-iodo-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide.
| Compound Name | 2-iodo-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 43903830 |
| Molecular Formula | C24H20IN3O5 |
| Molecular Weight | 557.34 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | 2-iodo-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
| SMILES | COc1cc(-c2noc(-c3ccccc3NC(=O)c3ccccc3I)n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H20IN3O5/c1-30-19-12-14(13-20(31-2)21(19)32-3)22-27-24(33-28-22)16-9-5-7-11-18(16)26-23(29)15-8-4-6-10-17(15)25/h4-13H,1-3H3,(H,26,29) |
| InChIKey | XQOWTTAACMTZFE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|