C25H22N4O7 — CID 30330219
4-methyl-3-nitro-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide (PubChem CID 30330219) has the molecular formula C25H22N4O7 and a molecular weight of 490.47 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 30330219 |
| Molecular Formula | C25H22N4O7 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 4-methyl-3-nitro-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
| SMILES | COc1cc(-c2noc(-c3ccccc3NC(=O)c3ccc(C)c([N+](=O)[O-])c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N4O7/c1-14-9-10-15(11-19(14)29(31)32)24(30)26-18-8-6-5-7-17(18)25-27-23(28-36-25)16-12-20(33-2)22(35-4)21(13-16)34-3/h5-13H,1-4H3,(H,26,30) |
| InChIKey | BMHNSXVBBQDRGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|