C13H10N2O4 — CID 79733049
5-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol (PubChem CID 79733049) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 5-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol.
| Compound Name | 5-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 79733049 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 5-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2nc(-c3ccco3)no2)cc1O |
| InChI | InChI=1S/C13H10N2O4/c1-17-10-5-4-8(7-9(10)16)13-14-12(15-19-13)11-3-2-6-18-11/h2-7,16H,1H3 |
| InChIKey | YFMFAJDOYMOZBO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |