C13H15N3O2 — CID 136938694
2-amino-6-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136938694) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-amino-6-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136938694 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-amino-6-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CC1(C)CC1c1noc(-c2cccc(N)c2O)n1 |
| InChI | InChI=1S/C13H15N3O2/c1-13(2)6-8(13)11-15-12(18-16-11)7-4-3-5-9(14)10(7)17/h3-5,8,17H,6,14H2,1-2H3 |
| InChIKey | KRPVJVVFSGTOOR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|