C13H15N3O3 — CID 136712744
2-amino-6-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136712744) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-amino-6-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136712744 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-amino-6-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cccc(-c2nc(C3CCCOC3)no2)c1O |
| InChI | InChI=1S/C13H15N3O3/c14-10-5-1-4-9(11(10)17)13-15-12(16-19-13)8-3-2-6-18-7-8/h1,4-5,8,17H,2-3,6-7,14H2 |
| InChIKey | IFTLNHMELZXYOQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|