C13H14N2O3 — CID 136678833
4-methyl-2-[3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136678833) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-methyl-2-[3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 4-methyl-2-[3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136678833 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-methyl-2-[3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Cc1ccc(O)c(-c2nc([C@@H]3CCOC3)no2)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-8-2-3-11(16)10(6-8)13-14-12(15-18-13)9-4-5-17-7-9/h2-3,6,9,16H,4-5,7H2,1H3/t9-/m1/s1 |
| InChIKey | UIRNPIIUBUQXAA-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |