C15H18N2O2 — CID 72939607
3-(oxolan-3-yl)-5-(2,4,5-trimethylphenyl)-1,2,4-oxadiazole (PubChem CID 72939607) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-5-(2,4,5-trimethylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(oxolan-3-yl)-5-(2,4,5-trimethylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 72939607 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(oxolan-3-yl)-5-(2,4,5-trimethylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)c(-c2nc(C3CCOC3)no2)cc1C |
| InChI | InChI=1S/C15H18N2O2/c1-9-6-11(3)13(7-10(9)2)15-16-14(17-19-15)12-4-5-18-8-12/h6-7,12H,4-5,8H2,1-3H3 |
| InChIKey | ASNFAKJPVLNEFY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |