C14H16N2O4 — CID 72911925
5-(2,3-dimethoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole (PubChem CID 72911925) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,3-dimethoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 72911925 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
| SMILES | COc1cccc(-c2nc(C3CCOC3)no2)c1OC |
| InChI | InChI=1S/C14H16N2O4/c1-17-11-5-3-4-10(12(11)18-2)14-15-13(16-20-14)9-6-7-19-8-9/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | MWSJIBJKEBIFIK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |