C15H18N2O5 — CID 97444955
3-[(3R)-oxolan-3-yl]-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 97444955) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-[(3R)-oxolan-3-yl]-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(3R)-oxolan-3-yl]-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97444955 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[(3R)-oxolan-3-yl]-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2nc([C@H]3CCOC3)no2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N2O5/c1-18-11-6-10(7-12(19-2)13(11)20-3)15-16-14(17-22-15)9-4-5-21-8-9/h6-7,9H,4-5,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | CHSUBWTUJOPRGH-VIFPVBQESA-N |
| XLogP | 2.27 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |