C13H13FN2O3 — CID 72911954
5-(4-fluoro-3-methoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole (PubChem CID 72911954) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-(4-fluoro-3-methoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-fluoro-3-methoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 72911954 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(4-fluoro-3-methoxyphenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2nc(C3CCOC3)no2)ccc1F |
| InChI | InChI=1S/C13H13FN2O3/c1-17-11-6-8(2-3-10(11)14)13-15-12(16-19-13)9-4-5-18-7-9/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | UPCKJDZWZNKANS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |