C15H19N3O — CID 107925129
2-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline (PubChem CID 107925129) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline.
| Compound Name | 2-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 107925129 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-[3-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(-c2nc(C3CC3(C)C)no2)c1 |
| InChI | InChI=1S/C15H19N3O/c1-8-5-9(2)12(16)10(6-8)14-17-13(18-19-14)11-7-15(11,3)4/h5-6,11H,7,16H2,1-4H3 |
| InChIKey | HKKBKODMEGKRMU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|