C17H23N3O — CID 65413071
2-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline (PubChem CID 65413071) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline.
| Compound Name | 2-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 65413071 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethylaniline |
| SMILES | CCC1CCC(c2noc(-c3cc(C)cc(C)c3N)n2)C1 |
| InChI | InChI=1S/C17H23N3O/c1-4-12-5-6-13(9-12)16-19-17(21-20-16)14-8-10(2)7-11(3)15(14)18/h7-8,12-13H,4-6,9,18H2,1-3H3 |
| InChIKey | CBDAYLOZYRYWIM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|