C16H21N3O — CID 65412668
5-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylaniline (PubChem CID 65412668) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 5-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylaniline.
| Compound Name | 5-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylaniline |
|---|---|
| PubChem CID | 65412668 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 5-[3-(3-ethylcyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylaniline |
| SMILES | CCC1CCC(c2noc(-c3ccc(C)c(N)c3)n2)C1 |
| InChI | InChI=1S/C16H21N3O/c1-3-11-5-7-12(8-11)15-18-16(20-19-15)13-6-4-10(2)14(17)9-13/h4,6,9,11-12H,3,5,7-8,17H2,1-2H3 |
| InChIKey | QGODQXKXZFTQIF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|