C12H12FN3O — CID 171795351
5-[3-[(1R,2S)-2-fluorocyclopropyl]-1,2,4-oxadiazol-5-yl]-2-methylaniline (PubChem CID 171795351) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 5-[3-[(1R,2S)-2-fluorocyclopropyl]-1,2,4-oxadiazol-5-yl]-2-methylaniline.
| Compound Name | 5-[3-[(1R,2S)-2-fluorocyclopropyl]-1,2,4-oxadiazol-5-yl]-2-methylaniline |
|---|---|
| PubChem CID | 171795351 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-[3-[(1R,2S)-2-fluorocyclopropyl]-1,2,4-oxadiazol-5-yl]-2-methylaniline |
| SMILES | Cc1ccc(-c2nc([C@H]3C[C@@H]3F)no2)cc1N |
| InChI | InChI=1S/C12H12FN3O/c1-6-2-3-7(4-10(6)14)12-15-11(16-17-12)8-5-9(8)13/h2-4,8-9H,5,14H2,1H3/t8-,9-/m0/s1 |
| InChIKey | URKZDHCRRQJSSE-IUCAKERBSA-N |
| XLogP | 2.45 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|