C12H17N3O — CID 171813495
ethane;2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 171813495) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is ethane;2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | ethane;2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 171813495 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | ethane;2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | CC.Cc1noc(-c2ccc(C)c(N)c2)n1 |
| InChI | InChI=1S/C10H11N3O.C2H6/c1-6-3-4-8(5-9(6)11)10-12-7(2)13-14-10;1-2/h3-5H,11H2,1-2H3;1-2H3 |
| InChIKey | ZVPDQTRIIRCTHD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|