C14H18N4O — CID 116806836
2,4-dimethyl-6-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 116806836) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,4-dimethyl-6-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 2,4-dimethyl-6-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 116806836 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2,4-dimethyl-6-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Cc1cc(C)c(N)c(-c2nc(N3CCCC3)no2)c1 |
| InChI | InChI=1S/C14H18N4O/c1-9-7-10(2)12(15)11(8-9)13-16-14(17-19-13)18-5-3-4-6-18/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | TWZBJGMKNBEORZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|