C12H13ClN4O — CID 116806560
4-chloro-3-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 116806560) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 4-chloro-3-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 4-chloro-3-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 116806560 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-chloro-3-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Nc1ccc(Cl)c(-c2nc(N3CCCC3)no2)c1 |
| InChI | InChI=1S/C12H13ClN4O/c13-10-4-3-8(14)7-9(10)11-15-12(16-18-11)17-5-1-2-6-17/h3-4,7H,1-2,5-6,14H2 |
| InChIKey | NDDQBTPDDURSPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|