C14H9Cl2N3O — CID 62100293
3-chloro-4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 62100293) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 3-chloro-4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-chloro-4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 62100293 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-chloro-4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3ccccc3Cl)no2)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-11-4-2-1-3-9(11)13-18-14(20-19-13)10-6-5-8(17)7-12(10)16/h1-7H,17H2 |
| InChIKey | CLVZAOPWJLGTOB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|