C13H8Cl2N4O — CID 103442570
4-chloro-3-[3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103442570) has the molecular formula C13H8Cl2N4O and a molecular weight of 307.14 g/mol. Its IUPAC name is 4-chloro-3-[3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-chloro-3-[3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103442570 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4-chloro-3-[3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(Cl)c(-c2nc(-c3ncccc3Cl)no2)c1 |
| InChI | InChI=1S/C13H8Cl2N4O/c14-9-4-3-7(16)6-8(9)13-18-12(19-20-13)11-10(15)2-1-5-17-11/h1-6H,16H2 |
| InChIKey | NONHNFBZUJLGDQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|