C11H10ClN3 — CID 18415424
2-(3-chloro-2-pyridinyl)benzene-1,4-diamine (PubChem CID 18415424) has the molecular formula C11H10ClN3 and a molecular weight of 219.68 g/mol. Its IUPAC name is 2-(3-chloro-2-pyridinyl)benzene-1,4-diamine.
| Compound Name | 2-(3-chloro-2-pyridinyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 18415424 |
| Molecular Formula | C11H10ClN3 |
| Molecular Weight | 219.68 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-(3-chloro-2-pyridinyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(-c2ncccc2Cl)c1 |
| InChI | InChI=1S/C11H10ClN3/c12-9-2-1-5-15-11(9)8-6-7(13)3-4-10(8)14/h1-6H,13-14H2 |
| InChIKey | BOSAQFAJWZXDPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|